C16H28N4O2S+2 — CID 9453718
N-cyclohexyl-5-(4-methylpiperazin-4-ium-1-yl)sulfonylpyridin-1-ium-2-amine (PubChem CID 9453718) has the molecular formula C16H28N4O2S+2 and a molecular weight of 340.49 g/mol. Its IUPAC name is N-cyclohexyl-5-(4-methylpiperazin-4-ium-1-yl)sulfonylpyridin-1-ium-2-amine.
| Compound Name | N-cyclohexyl-5-(4-methylpiperazin-4-ium-1-yl)sulfonylpyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9453718 |
| Molecular Formula | C16H28N4O2S+2 |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-cyclohexyl-5-(4-methylpiperazin-4-ium-1-yl)sulfonylpyridin-1-ium-2-amine |
| SMILES | C[NH+]1CCN(S(=O)(=O)c2ccc(NC3CCCCC3)[nH+]c2)CC1 |
| InChI | InChI=1S/C16H26N4O2S/c1-19-9-11-20(12-10-19)23(21,22)15-7-8-16(17-13-15)18-14-5-3-2-4-6-14/h7-8,13-14H,2-6,9-12H2,1H3,(H,17,18)/p+2 |
| InChIKey | ZKBCUEWSZRGTEJ-UHFFFAOYSA-P |
| XLogP | -0.24 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |