C18H30N3O4S+ — CID 9025296
N-(3-cyclohexyloxypropyl)-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine (PubChem CID 9025296) has the molecular formula C18H30N3O4S+ and a molecular weight of 384.52 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine.
| Compound Name | N-(3-cyclohexyloxypropyl)-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9025296 |
| Molecular Formula | C18H30N3O4S+ |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine |
| SMILES | O=S(=O)(c1ccc(NCCCOC2CCCCC2)[nH+]c1)N1CCOCC1 |
| InChI | InChI=1S/C18H29N3O4S/c22-26(23,21-10-13-24-14-11-21)17-7-8-18(20-15-17)19-9-4-12-25-16-5-2-1-3-6-16/h7-8,15-16H,1-6,9-14H2,(H,19,20)/p+1 |
| InChIKey | QJYBQTQVXFRSHO-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|