C20H30N4O3S+2 — CID 9024165
benzyl-methyl-[3-[(5-morpholin-4-ylsulfonylpyridin-1-ium-2-yl)amino]propyl]azanium (PubChem CID 9024165) has the molecular formula C20H30N4O3S+2 and a molecular weight of 406.55 g/mol. Its IUPAC name is benzyl-methyl-[3-[(5-morpholin-4-ylsulfonylpyridin-1-ium-2-yl)amino]propyl]azanium.
| Compound Name | benzyl-methyl-[3-[(5-morpholin-4-ylsulfonylpyridin-1-ium-2-yl)amino]propyl]azanium |
|---|---|
| PubChem CID | 9024165 |
| Molecular Formula | C20H30N4O3S+2 |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | benzyl-methyl-[3-[(5-morpholin-4-ylsulfonylpyridin-1-ium-2-yl)amino]propyl]azanium |
| SMILES | C[NH+](CCCNc1ccc(S(=O)(=O)N2CCOCC2)c[nH+]1)Cc1ccccc1 |
| InChI | InChI=1S/C20H28N4O3S/c1-23(17-18-6-3-2-4-7-18)11-5-10-21-20-9-8-19(16-22-20)28(25,26)24-12-14-27-15-13-24/h2-4,6-9,16H,5,10-15,17H2,1H3,(H,21,22)/p+2 |
| InChIKey | JEPICLNYPYDFDP-UHFFFAOYSA-P |
| XLogP | 0.04 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|