C15H20N3O3S2+ — CID 9109319
5-morpholin-4-ylsulfonyl-N-[(1S)-1-thiophen-2-ylethyl]pyridin-1-ium-2-amine (PubChem CID 9109319) has the molecular formula C15H20N3O3S2+ and a molecular weight of 354.48 g/mol. Its IUPAC name is 5-morpholin-4-ylsulfonyl-N-[(1S)-1-thiophen-2-ylethyl]pyridin-1-ium-2-amine.
| Compound Name | 5-morpholin-4-ylsulfonyl-N-[(1S)-1-thiophen-2-ylethyl]pyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9109319 |
| Molecular Formula | C15H20N3O3S2+ |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 5-morpholin-4-ylsulfonyl-N-[(1S)-1-thiophen-2-ylethyl]pyridin-1-ium-2-amine |
| SMILES | C[C@H](Nc1ccc(S(=O)(=O)N2CCOCC2)c[nH+]1)c1cccs1 |
| InChI | InChI=1S/C15H19N3O3S2/c1-12(14-3-2-10-22-14)17-15-5-4-13(11-16-15)23(19,20)18-6-8-21-9-7-18/h2-5,10-12H,6-9H2,1H3,(H,16,17)/p+1/t12-/m0/s1 |
| InChIKey | LTXXTPGDNLETJQ-LBPRGKRZSA-O |
| XLogP | 1.76 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |