C16H28N4O4S+2 — CID 9280285
N-(3-morpholin-4-ium-4-ylpropyl)-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine (PubChem CID 9280285) has the molecular formula C16H28N4O4S+2 and a molecular weight of 372.49 g/mol. Its IUPAC name is N-(3-morpholin-4-ium-4-ylpropyl)-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine.
| Compound Name | N-(3-morpholin-4-ium-4-ylpropyl)-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9280285 |
| Molecular Formula | C16H28N4O4S+2 |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-(3-morpholin-4-ium-4-ylpropyl)-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine |
| SMILES | O=S(=O)(c1ccc(NCCC[NH+]2CCOCC2)[nH+]c1)N1CCOCC1 |
| InChI | InChI=1S/C16H26N4O4S/c21-25(22,20-8-12-24-13-9-20)15-2-3-16(18-14-15)17-4-1-5-19-6-10-23-11-7-19/h2-3,14H,1,4-13H2,(H,17,18)/p+2 |
| InChIKey | FCCLLXUZKMOPNF-UHFFFAOYSA-P |
| XLogP | -1.76 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|