C21H32N3O3S+ — CID 9283334
N-[(1S)-1-(1-adamantyl)ethyl]-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine (PubChem CID 9283334) has the molecular formula C21H32N3O3S+ and a molecular weight of 406.57 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9283334 |
| Molecular Formula | C21H32N3O3S+ |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine |
| SMILES | C[C@H](Nc1ccc(S(=O)(=O)N2CCOCC2)c[nH+]1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H31N3O3S/c1-15(21-11-16-8-17(12-21)10-18(9-16)13-21)23-20-3-2-19(14-22-20)28(25,26)24-4-6-27-7-5-24/h2-3,14-18H,4-13H2,1H3,(H,22,23)/p+1/t15-,16?,17?,18?,21?/m0/s1 |
| InChIKey | RFVOTEJJOLMDFS-SIHNGCNOSA-O |
| XLogP | 2.54 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |