C18H24N3O3S2+ — CID 8565448
N-[2-(4-methylphenyl)sulfanylethyl]-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine (PubChem CID 8565448) has the molecular formula C18H24N3O3S2+ and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[2-(4-methylphenyl)sulfanylethyl]-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine.
| Compound Name | N-[2-(4-methylphenyl)sulfanylethyl]-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 8565448 |
| Molecular Formula | C18H24N3O3S2+ |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-[2-(4-methylphenyl)sulfanylethyl]-5-morpholin-4-ylsulfonylpyridin-1-ium-2-amine |
| SMILES | Cc1ccc(SCCNc2ccc(S(=O)(=O)N3CCOCC3)c[nH+]2)cc1 |
| InChI | InChI=1S/C18H23N3O3S2/c1-15-2-4-16(5-3-15)25-13-8-19-18-7-6-17(14-20-18)26(22,23)21-9-11-24-12-10-21/h2-7,14H,8-13H2,1H3,(H,19,20)/p+1 |
| InChIKey | SXNHOGJQSCPQEM-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|