C14H22N3O3S+ — CID 9196183
4-(6-piperidin-1-ylpyridin-1-ium-3-yl)sulfonylmorpholine (PubChem CID 9196183) has the molecular formula C14H22N3O3S+ and a molecular weight of 312.42 g/mol. Its IUPAC name is 4-(6-piperidin-1-ylpyridin-1-ium-3-yl)sulfonylmorpholine.
| Compound Name | 4-(6-piperidin-1-ylpyridin-1-ium-3-yl)sulfonylmorpholine |
|---|---|
| PubChem CID | 9196183 |
| Molecular Formula | C14H22N3O3S+ |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-(6-piperidin-1-ylpyridin-1-ium-3-yl)sulfonylmorpholine |
| SMILES | O=S(=O)(c1ccc(N2CCCCC2)[nH+]c1)N1CCOCC1 |
| InChI | InChI=1S/C14H21N3O3S/c18-21(19,17-8-10-20-11-9-17)13-4-5-14(15-12-13)16-6-2-1-3-7-16/h4-5,12H,1-3,6-11H2/p+1 |
| InChIKey | IIBSVTDDRLUKDY-UHFFFAOYSA-O |
| XLogP | 0.51 |
| TPSA | 63.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |