C17H25N3O5S — CID 55463879
methyl 2-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylanilino)acetate (PubChem CID 55463879) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is methyl 2-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylanilino)acetate.
| Compound Name | methyl 2-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylanilino)acetate |
|---|---|
| PubChem CID | 55463879 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | methyl 2-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylanilino)acetate |
| SMILES | COC(=O)CNc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCCC1 |
| InChI | InChI=1S/C17H25N3O5S/c1-24-17(21)13-18-15-12-14(4-5-16(15)19-6-2-3-7-19)26(22,23)20-8-10-25-11-9-20/h4-5,12,18H,2-3,6-11,13H2,1H3 |
| InChIKey | KUGPJDINALOWEC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |