C22H29N3O6S — CID 24624008
ethyl 2-[(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylanilino)methyl]furan-3-carboxylate (PubChem CID 24624008) has the molecular formula C22H29N3O6S and a molecular weight of 463.56 g/mol. Its IUPAC name is ethyl 2-[(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylanilino)methyl]furan-3-carboxylate.
| Compound Name | ethyl 2-[(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylanilino)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 24624008 |
| Molecular Formula | C22H29N3O6S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | ethyl 2-[(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylanilino)methyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1ccoc1CNc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCCC1 |
| InChI | InChI=1S/C22H29N3O6S/c1-2-30-22(26)18-7-12-31-21(18)16-23-19-15-17(5-6-20(19)24-8-3-4-9-24)32(27,28)25-10-13-29-14-11-25/h5-7,12,15,23H,2-4,8-11,13-14,16H2,1H3 |
| InChIKey | ZCRBIIJXBUEYBK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |