C24H38N4O4S — CID 55346771
N-(2-methylcyclohexyl)-2-(2-morpholin-4-yl-5-piperidin-1-ylsulfonylanilino)acetamide (PubChem CID 55346771) has the molecular formula C24H38N4O4S and a molecular weight of 478.66 g/mol. Its IUPAC name is N-(2-methylcyclohexyl)-2-(2-morpholin-4-yl-5-piperidin-1-ylsulfonylanilino)acetamide.
| Compound Name | N-(2-methylcyclohexyl)-2-(2-morpholin-4-yl-5-piperidin-1-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 55346771 |
| Molecular Formula | C24H38N4O4S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | N-(2-methylcyclohexyl)-2-(2-morpholin-4-yl-5-piperidin-1-ylsulfonylanilino)acetamide |
| SMILES | CC1CCCCC1NC(=O)CNc1cc(S(=O)(=O)N2CCCCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C24H38N4O4S/c1-19-7-3-4-8-21(19)26-24(29)18-25-22-17-20(33(30,31)28-11-5-2-6-12-28)9-10-23(22)27-13-15-32-16-14-27/h9-10,17,19,21,25H,2-8,11-16,18H2,1H3,(H,26,29) |
| InChIKey | IZRKVAHUMAEYAX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |