C20H27N4O3S+ — CID 9282203
2-[4-(5-piperidin-1-ylsulfonylpyridin-1-ium-2-yl)piperazin-1-yl]phenol (PubChem CID 9282203) has the molecular formula C20H27N4O3S+ and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-[4-(5-piperidin-1-ylsulfonylpyridin-1-ium-2-yl)piperazin-1-yl]phenol.
| Compound Name | 2-[4-(5-piperidin-1-ylsulfonylpyridin-1-ium-2-yl)piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 9282203 |
| Molecular Formula | C20H27N4O3S+ |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 2-[4-(5-piperidin-1-ylsulfonylpyridin-1-ium-2-yl)piperazin-1-yl]phenol |
| SMILES | O=S(=O)(c1ccc(N2CCN(c3ccccc3O)CC2)[nH+]c1)N1CCCCC1 |
| InChI | InChI=1S/C20H26N4O3S/c25-19-7-3-2-6-18(19)22-12-14-23(15-13-22)20-9-8-17(16-21-20)28(26,27)24-10-4-1-5-11-24/h2-3,6-9,16,25H,1,4-5,10-15H2/p+1 |
| InChIKey | SRKCZTRJMZATEL-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |