About 1-methylsulfonylpiperidine;2-piperazin-1-ylphenol
1-methylsulfonylpiperidine;2-piperazin-1-ylphenol (PubChem CID 142156439) has the molecular formula C16H27N3O3S
and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-methylsulfonylpiperidine;2-piperazin-1-ylphenol.
Molecular Properties
| Compound Name | 1-methylsulfonylpiperidine;2-piperazin-1-ylphenol |
| PubChem CID | 142156439 |
| Molecular Formula | C16H27N3O3S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 1-methylsulfonylpiperidine;2-piperazin-1-ylphenol |
| SMILES | CS(=O)(=O)N1CCCCC1.Oc1ccccc1N1CCNCC1 |
| InChI | InChI=1S/C10H14N2O.C6H13NO2S/c13-10-4-2-1-3-9(10)12-7-5-11-6-8-12;1-10(8,9)7-5-3-2-4-6-7/h1-4,11,13H,5-8H2;2-6H2,1H3 |
| InChIKey | RBNPAKPLBMRYAI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methylsulfonylpiperidine;2-piperazin-1-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfonylpiperidine;2-piperazin-1-ylphenol?
The IUPAC name of 1-methylsulfonylpiperidine;2-piperazin-1-ylphenol (CID 142156439) is 1-methylsulfonylpiperidine;2-piperazin-1-ylphenol.
What is the SMILES notation for 1-methylsulfonylpiperidine;2-piperazin-1-ylphenol?
The canonical SMILES for 1-methylsulfonylpiperidine;2-piperazin-1-ylphenol is CS(=O)(=O)N1CCCCC1.Oc1ccccc1N1CCNCC1.
What is the InChIKey of 1-methylsulfonylpiperidine;2-piperazin-1-ylphenol?
The InChIKey is RBNPAKPLBMRYAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O.C6H13NO2S/c13-10-4-2-1-3-9(10)12-7-5-11-6-8-12;1-10(8,9)7-5-3-2-4-6-7/h1-4,11,13H,5-8H2;2-6H2,1H3.
What are the key properties of 1-methylsulfonylpiperidine;2-piperazin-1-ylphenol?
1-methylsulfonylpiperidine;2-piperazin-1-ylphenol has a molecular weight of 341.48 g/mol, XLogP of 1.23, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfonylpiperidine;2-piperazin-1-ylphenol is sourced from PubChem (CID 142156439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).