C19H24N4O4S — CID 9282198
2-[4-(5-morpholin-4-ylsulfonyl-2-pyridinyl)piperazin-1-yl]phenol (PubChem CID 9282198) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-[4-(5-morpholin-4-ylsulfonyl-2-pyridinyl)piperazin-1-yl]phenol.
| Compound Name | 2-[4-(5-morpholin-4-ylsulfonyl-2-pyridinyl)piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 9282198 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-[4-(5-morpholin-4-ylsulfonyl-2-pyridinyl)piperazin-1-yl]phenol |
| SMILES | O=S(=O)(c1ccc(N2CCN(c3ccccc3O)CC2)nc1)N1CCOCC1 |
| InChI | InChI=1S/C19H24N4O4S/c24-18-4-2-1-3-17(18)21-7-9-22(10-8-21)19-6-5-16(15-20-19)28(25,26)23-11-13-27-14-12-23/h1-6,15,24H,7-14H2 |
| InChIKey | XFRSUWFTNDRXKI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |