C17H28N4O3S — CID 133322499
4-[[6-(4-propyl-1,4-diazepan-1-yl)-3-pyridinyl]sulfonyl]morpholine (PubChem CID 133322499) has the molecular formula C17H28N4O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is 4-[[6-(4-propyl-1,4-diazepan-1-yl)-3-pyridinyl]sulfonyl]morpholine.
| Compound Name | 4-[[6-(4-propyl-1,4-diazepan-1-yl)-3-pyridinyl]sulfonyl]morpholine |
|---|---|
| PubChem CID | 133322499 |
| Molecular Formula | C17H28N4O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 4-[[6-(4-propyl-1,4-diazepan-1-yl)-3-pyridinyl]sulfonyl]morpholine |
| SMILES | CCCN1CCCN(c2ccc(S(=O)(=O)N3CCOCC3)cn2)CC1 |
| InChI | InChI=1S/C17H28N4O3S/c1-2-6-19-7-3-8-20(10-9-19)17-5-4-16(15-18-17)25(22,23)21-11-13-24-14-12-21/h4-5,15H,2-3,6-14H2,1H3 |
| InChIKey | JYAJFHDXUKOQRL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |