C23H32N4O3S — CID 23154459
4-[4-[6-[4-(2-methylpropyl)piperazin-1-yl]-3-pyridinyl]phenyl]sulfonylmorpholine (PubChem CID 23154459) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is 4-[4-[6-[4-(2-methylpropyl)piperazin-1-yl]-3-pyridinyl]phenyl]sulfonylmorpholine.
| Compound Name | 4-[4-[6-[4-(2-methylpropyl)piperazin-1-yl]-3-pyridinyl]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 23154459 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 4-[4-[6-[4-(2-methylpropyl)piperazin-1-yl]-3-pyridinyl]phenyl]sulfonylmorpholine |
| SMILES | CC(C)CN1CCN(c2ccc(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)cn2)CC1 |
| InChI | InChI=1S/C23H32N4O3S/c1-19(2)18-25-9-11-26(12-10-25)23-8-5-21(17-24-23)20-3-6-22(7-4-20)31(28,29)27-13-15-30-16-14-27/h3-8,17,19H,9-16,18H2,1-2H3 |
| InChIKey | MBGJWTXXTYRLJU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |