C22H29FN4O4S — CID 24595663
4-[[6-[4-[3-(4-fluorophenoxy)propyl]piperazin-1-yl]-3-pyridinyl]sulfonyl]morpholine (PubChem CID 24595663) has the molecular formula C22H29FN4O4S and a molecular weight of 464.56 g/mol. Its IUPAC name is 4-[[6-[4-[3-(4-fluorophenoxy)propyl]piperazin-1-yl]-3-pyridinyl]sulfonyl]morpholine.
| Compound Name | 4-[[6-[4-[3-(4-fluorophenoxy)propyl]piperazin-1-yl]-3-pyridinyl]sulfonyl]morpholine |
|---|---|
| PubChem CID | 24595663 |
| Molecular Formula | C22H29FN4O4S |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 4-[[6-[4-[3-(4-fluorophenoxy)propyl]piperazin-1-yl]-3-pyridinyl]sulfonyl]morpholine |
| SMILES | O=S(=O)(c1ccc(N2CCN(CCCOc3ccc(F)cc3)CC2)nc1)N1CCOCC1 |
| InChI | InChI=1S/C22H29FN4O4S/c23-19-2-4-20(5-3-19)31-15-1-8-25-9-11-26(12-10-25)22-7-6-21(18-24-22)32(28,29)27-13-16-30-17-14-27/h2-7,18H,1,8-17H2 |
| InChIKey | AKCLRTAKRAGLBF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 75.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|