C23H28N6O3S — CID 43039470
4-[[6-[4-[(4-pyrazol-1-ylphenyl)methyl]piperazin-1-yl]-3-pyridinyl]sulfonyl]morpholine (PubChem CID 43039470) has the molecular formula C23H28N6O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is 4-[[6-[4-[(4-pyrazol-1-ylphenyl)methyl]piperazin-1-yl]-3-pyridinyl]sulfonyl]morpholine.
| Compound Name | 4-[[6-[4-[(4-pyrazol-1-ylphenyl)methyl]piperazin-1-yl]-3-pyridinyl]sulfonyl]morpholine |
|---|---|
| PubChem CID | 43039470 |
| Molecular Formula | C23H28N6O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 4-[[6-[4-[(4-pyrazol-1-ylphenyl)methyl]piperazin-1-yl]-3-pyridinyl]sulfonyl]morpholine |
| SMILES | O=S(=O)(c1ccc(N2CCN(Cc3ccc(-n4cccn4)cc3)CC2)nc1)N1CCOCC1 |
| InChI | InChI=1S/C23H28N6O3S/c30-33(31,28-14-16-32-17-15-28)22-6-7-23(24-18-22)27-12-10-26(11-13-27)19-20-2-4-21(5-3-20)29-9-1-8-25-29/h1-9,18H,10-17,19H2 |
| InChIKey | GQXRKFOXHHGHOM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |