C22H27N7O3S — CID 43039484
2-[[4-(5-morpholin-4-ylsulfonyl-2-pyridinyl)piperazin-1-yl]methyl]quinazolin-4-amine (PubChem CID 43039484) has the molecular formula C22H27N7O3S and a molecular weight of 469.57 g/mol. Its IUPAC name is 2-[[4-(5-morpholin-4-ylsulfonyl-2-pyridinyl)piperazin-1-yl]methyl]quinazolin-4-amine.
| Compound Name | 2-[[4-(5-morpholin-4-ylsulfonyl-2-pyridinyl)piperazin-1-yl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 43039484 |
| Molecular Formula | C22H27N7O3S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 2-[[4-(5-morpholin-4-ylsulfonyl-2-pyridinyl)piperazin-1-yl]methyl]quinazolin-4-amine |
| SMILES | Nc1nc(CN2CCN(c3ccc(S(=O)(=O)N4CCOCC4)cn3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C22H27N7O3S/c23-22-18-3-1-2-4-19(18)25-20(26-22)16-27-7-9-28(10-8-27)21-6-5-17(15-24-21)33(30,31)29-11-13-32-14-12-29/h1-6,15H,7-14,16H2,(H2,23,25,26) |
| InChIKey | JAHBWQDCRFMYKQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |