C20H21F2N5O2S — CID 133333574
2-[[4-[4-(difluoromethylsulfonyl)phenyl]piperazin-1-yl]methyl]quinazolin-4-amine (PubChem CID 133333574) has the molecular formula C20H21F2N5O2S and a molecular weight of 433.48 g/mol. Its IUPAC name is 2-[[4-[4-(difluoromethylsulfonyl)phenyl]piperazin-1-yl]methyl]quinazolin-4-amine.
| Compound Name | 2-[[4-[4-(difluoromethylsulfonyl)phenyl]piperazin-1-yl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 133333574 |
| Molecular Formula | C20H21F2N5O2S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 2-[[4-[4-(difluoromethylsulfonyl)phenyl]piperazin-1-yl]methyl]quinazolin-4-amine |
| SMILES | Nc1nc(CN2CCN(c3ccc(S(=O)(=O)C(F)F)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C20H21F2N5O2S/c21-20(22)30(28,29)15-7-5-14(6-8-15)27-11-9-26(10-12-27)13-18-24-17-4-2-1-3-16(17)19(23)25-18/h1-8,20H,9-13H2,(H2,23,24,25) |
| InChIKey | WSIUNIOZSVKDDE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |