C17H28N4O2S — CID 133322500
1-propyl-4-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)-1,4-diazepane (PubChem CID 133322500) has the molecular formula C17H28N4O2S and a molecular weight of 352.50 g/mol. Its IUPAC name is 1-propyl-4-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)-1,4-diazepane.
| Compound Name | 1-propyl-4-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 133322500 |
| Molecular Formula | C17H28N4O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-propyl-4-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)-1,4-diazepane |
| SMILES | CCCN1CCCN(c2ccc(S(=O)(=O)N3CCCC3)cn2)CC1 |
| InChI | InChI=1S/C17H28N4O2S/c1-2-8-19-9-5-10-20(14-13-19)17-7-6-16(15-18-17)24(22,23)21-11-3-4-12-21/h6-7,15H,2-5,8-14H2,1H3 |
| InChIKey | OZPZIBDPZFEOGW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |