C16H24N4O3S — CID 3000054
1-[4-(5-piperidin-1-ylsulfonyl-2-pyridinyl)piperazin-1-yl]ethanone (PubChem CID 3000054) has the molecular formula C16H24N4O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-[4-(5-piperidin-1-ylsulfonyl-2-pyridinyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(5-piperidin-1-ylsulfonyl-2-pyridinyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 3000054 |
| Molecular Formula | C16H24N4O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-[4-(5-piperidin-1-ylsulfonyl-2-pyridinyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(S(=O)(=O)N3CCCCC3)cn2)CC1 |
| InChI | InChI=1S/C16H24N4O3S/c1-14(21)18-9-11-19(12-10-18)16-6-5-15(13-17-16)24(22,23)20-7-3-2-4-8-20/h5-6,13H,2-4,7-12H2,1H3 |
| InChIKey | BNDWIWCKYBUTIZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |