C20H25ClN4O2S — CID 9282287
1-(3-chlorophenyl)-4-(5-piperidin-1-ylsulfonyl-2-pyridinyl)piperazine (PubChem CID 9282287) has the molecular formula C20H25ClN4O2S and a molecular weight of 420.97 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-(5-piperidin-1-ylsulfonyl-2-pyridinyl)piperazine.
| Compound Name | 1-(3-chlorophenyl)-4-(5-piperidin-1-ylsulfonyl-2-pyridinyl)piperazine |
|---|---|
| PubChem CID | 9282287 |
| Molecular Formula | C20H25ClN4O2S |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-(3-chlorophenyl)-4-(5-piperidin-1-ylsulfonyl-2-pyridinyl)piperazine |
| SMILES | O=S(=O)(c1ccc(N2CCN(c3cccc(Cl)c3)CC2)nc1)N1CCCCC1 |
| InChI | InChI=1S/C20H25ClN4O2S/c21-17-5-4-6-18(15-17)23-11-13-24(14-12-23)20-8-7-19(16-22-20)28(26,27)25-9-2-1-3-10-25/h4-8,15-16H,1-3,9-14H2 |
| InChIKey | MOJNFTFEEDSMBS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |