C19H28N4O3S — CID 36727474
cyclopentyl-[4-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)piperazin-1-yl]methanone (PubChem CID 36727474) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is cyclopentyl-[4-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)piperazin-1-yl]methanone.
| Compound Name | cyclopentyl-[4-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 36727474 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | cyclopentyl-[4-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CCCC1)N1CCN(c2ccc(S(=O)(=O)N3CCCC3)cn2)CC1 |
| InChI | InChI=1S/C19H28N4O3S/c24-19(16-5-1-2-6-16)22-13-11-21(12-14-22)18-8-7-17(15-20-18)27(25,26)23-9-3-4-10-23/h7-8,15-16H,1-6,9-14H2 |
| InChIKey | PTJOYMBLDKBCCJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |