C22H28N4O3S — CID 51927781
(3S)-N-phenyl-1-(5-piperidin-1-ylsulfonyl-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 51927781) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is (3S)-N-phenyl-1-(5-piperidin-1-ylsulfonyl-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-phenyl-1-(5-piperidin-1-ylsulfonyl-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 51927781 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (3S)-N-phenyl-1-(5-piperidin-1-ylsulfonyl-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@H]1CCCN(c2ccc(S(=O)(=O)N3CCCCC3)cn2)C1 |
| InChI | InChI=1S/C22H28N4O3S/c27-22(24-19-9-3-1-4-10-19)18-8-7-13-25(17-18)21-12-11-20(16-23-21)30(28,29)26-14-5-2-6-15-26/h1,3-4,9-12,16,18H,2,5-8,13-15,17H2,(H,24,27)/t18-/m0/s1 |
| InChIKey | LBLRMVWJFWASFX-SFHVURJKSA-N |
| XLogP | 3.11 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |