C26H30N4O3S — CID 50769456
N-phenyl-1-(6-piperidin-1-ylsulfonylquinolin-2-yl)piperidine-3-carboxamide (PubChem CID 50769456) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is N-phenyl-1-(6-piperidin-1-ylsulfonylquinolin-2-yl)piperidine-3-carboxamide.
| Compound Name | N-phenyl-1-(6-piperidin-1-ylsulfonylquinolin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 50769456 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | N-phenyl-1-(6-piperidin-1-ylsulfonylquinolin-2-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCCN(c2ccc3cc(S(=O)(=O)N4CCCCC4)ccc3n2)C1 |
| InChI | InChI=1S/C26H30N4O3S/c31-26(27-22-9-3-1-4-10-22)21-8-7-15-29(19-21)25-14-11-20-18-23(12-13-24(20)28-25)34(32,33)30-16-5-2-6-17-30/h1,3-4,9-14,18,21H,2,5-8,15-17,19H2,(H,27,31) |
| InChIKey | MNIRAAJUYTZQJM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |