C25H34N4O3S — CID 50769435
piperidin-1-yl-[1-(6-piperidin-1-ylsulfonylquinolin-2-yl)piperidin-3-yl]methanone (PubChem CID 50769435) has the molecular formula C25H34N4O3S and a molecular weight of 470.64 g/mol. Its IUPAC name is piperidin-1-yl-[1-(6-piperidin-1-ylsulfonylquinolin-2-yl)piperidin-3-yl]methanone.
| Compound Name | piperidin-1-yl-[1-(6-piperidin-1-ylsulfonylquinolin-2-yl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 50769435 |
| Molecular Formula | C25H34N4O3S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | piperidin-1-yl-[1-(6-piperidin-1-ylsulfonylquinolin-2-yl)piperidin-3-yl]methanone |
| SMILES | O=C(C1CCCN(c2ccc3cc(S(=O)(=O)N4CCCCC4)ccc3n2)C1)N1CCCCC1 |
| InChI | InChI=1S/C25H34N4O3S/c30-25(27-13-3-1-4-14-27)21-8-7-15-28(19-21)24-12-9-20-18-22(10-11-23(20)26-24)33(31,32)29-16-5-2-6-17-29/h9-12,18,21H,1-8,13-17,19H2 |
| InChIKey | PUYFNVYLKKGVIU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |