C25H27ClN4O3S — CID 50806788
N-(3-chlorophenyl)-1-(6-pyrrolidin-1-ylsulfonylquinolin-2-yl)piperidine-3-carboxamide (PubChem CID 50806788) has the molecular formula C25H27ClN4O3S and a molecular weight of 499.04 g/mol. Its IUPAC name is N-(3-chlorophenyl)-1-(6-pyrrolidin-1-ylsulfonylquinolin-2-yl)piperidine-3-carboxamide.
| Compound Name | N-(3-chlorophenyl)-1-(6-pyrrolidin-1-ylsulfonylquinolin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 50806788 |
| Molecular Formula | C25H27ClN4O3S |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-(3-chlorophenyl)-1-(6-pyrrolidin-1-ylsulfonylquinolin-2-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)C1CCCN(c2ccc3cc(S(=O)(=O)N4CCCC4)ccc3n2)C1 |
| InChI | InChI=1S/C25H27ClN4O3S/c26-20-6-3-7-21(16-20)27-25(31)19-5-4-12-29(17-19)24-11-8-18-15-22(9-10-23(18)28-24)34(32,33)30-13-1-2-14-30/h3,6-11,15-16,19H,1-2,4-5,12-14,17H2,(H,27,31) |
| InChIKey | MOLIPGKQPRGEOE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |