C19H26ClN4O2S+ — CID 9281715
6-[4-(2-chlorophenyl)piperazin-1-yl]-N,N-diethylpyridin-1-ium-3-sulfonamide (PubChem CID 9281715) has the molecular formula C19H26ClN4O2S+ and a molecular weight of 409.96 g/mol. Its IUPAC name is 6-[4-(2-chlorophenyl)piperazin-1-yl]-N,N-diethylpyridin-1-ium-3-sulfonamide.
| Compound Name | 6-[4-(2-chlorophenyl)piperazin-1-yl]-N,N-diethylpyridin-1-ium-3-sulfonamide |
|---|---|
| PubChem CID | 9281715 |
| Molecular Formula | C19H26ClN4O2S+ |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 6-[4-(2-chlorophenyl)piperazin-1-yl]-N,N-diethylpyridin-1-ium-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCN(c3ccccc3Cl)CC2)[nH+]c1 |
| InChI | InChI=1S/C19H25ClN4O2S/c1-3-24(4-2)27(25,26)16-9-10-19(21-15-16)23-13-11-22(12-14-23)18-8-6-5-7-17(18)20/h5-10,15H,3-4,11-14H2,1-2H3/p+1 |
| InChIKey | YVYMQQUMJLVKTR-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 58.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |