C19H28N4O2S+2 — CID 9211443
N-ethyl-6-(4-ethylpiperazin-4-ium-1-yl)-N-phenylpyridin-1-ium-3-sulfonamide (PubChem CID 9211443) has the molecular formula C19H28N4O2S+2 and a molecular weight of 376.53 g/mol. Its IUPAC name is N-ethyl-6-(4-ethylpiperazin-4-ium-1-yl)-N-phenylpyridin-1-ium-3-sulfonamide.
| Compound Name | N-ethyl-6-(4-ethylpiperazin-4-ium-1-yl)-N-phenylpyridin-1-ium-3-sulfonamide |
|---|---|
| PubChem CID | 9211443 |
| Molecular Formula | C19H28N4O2S+2 |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-ethyl-6-(4-ethylpiperazin-4-ium-1-yl)-N-phenylpyridin-1-ium-3-sulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(N2CC[NH+](CC)CC2)[nH+]c1 |
| InChI | InChI=1S/C19H26N4O2S/c1-3-21-12-14-22(15-13-21)19-11-10-18(16-20-19)26(24,25)23(4-2)17-8-6-5-7-9-17/h5-11,16H,3-4,12-15H2,1-2H3/p+2 |
| InChIKey | SDROPIHMKYBFML-UHFFFAOYSA-P |
| XLogP | 0.44 |
| TPSA | 59.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |