C20H25ClN3O3S+ — CID 2334711
4-chloro-3-(4-ethylpiperazin-4-ium-1-carbonyl)-N-methyl-N-phenylbenzenesulfonamide (PubChem CID 2334711) has the molecular formula C20H25ClN3O3S+ and a molecular weight of 422.96 g/mol. Its IUPAC name is 4-chloro-3-(4-ethylpiperazin-4-ium-1-carbonyl)-N-methyl-N-phenylbenzenesulfonamide.
| Compound Name | 4-chloro-3-(4-ethylpiperazin-4-ium-1-carbonyl)-N-methyl-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 2334711 |
| Molecular Formula | C20H25ClN3O3S+ |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 4-chloro-3-(4-ethylpiperazin-4-ium-1-carbonyl)-N-methyl-N-phenylbenzenesulfonamide |
| SMILES | CC[NH+]1CCN(C(=O)c2cc(S(=O)(=O)N(C)c3ccccc3)ccc2Cl)CC1 |
| InChI | InChI=1S/C20H24ClN3O3S/c1-3-23-11-13-24(14-12-23)20(25)18-15-17(9-10-19(18)21)28(26,27)22(2)16-7-5-4-6-8-16/h4-10,15H,3,11-14H2,1-2H3/p+1 |
| InChIKey | GDJCBIHBFXYEIE-UHFFFAOYSA-O |
| XLogP | 1.53 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |