C14H13Cl2NO2S — CID 2234505
3,4-dichloro-N-ethyl-N-phenylbenzenesulfonamide (PubChem CID 2234505) has the molecular formula C14H13Cl2NO2S and a molecular weight of 330.24 g/mol. Its IUPAC name is 3,4-dichloro-N-ethyl-N-phenylbenzenesulfonamide.
| Compound Name | 3,4-dichloro-N-ethyl-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 2234505 |
| Molecular Formula | C14H13Cl2NO2S |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 3,4-dichloro-N-ethyl-N-phenylbenzenesulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2NO2S/c1-2-17(11-6-4-3-5-7-11)20(18,19)12-8-9-13(15)14(16)10-12/h3-10H,2H2,1H3 |
| InChIKey | IUVLHWSMMLIKSW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |