C15H13Cl2NO4S — CID 50889553
methyl 2-(N-(3,4-dichlorophenyl)sulfonylanilino)acetate (PubChem CID 50889553) has the molecular formula C15H13Cl2NO4S and a molecular weight of 374.25 g/mol. Its IUPAC name is methyl 2-(N-(3,4-dichlorophenyl)sulfonylanilino)acetate.
| Compound Name | methyl 2-(N-(3,4-dichlorophenyl)sulfonylanilino)acetate |
|---|---|
| PubChem CID | 50889553 |
| Molecular Formula | C15H13Cl2NO4S |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | methyl 2-(N-(3,4-dichlorophenyl)sulfonylanilino)acetate |
| SMILES | COC(=O)CN(c1ccccc1)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2NO4S/c1-22-15(19)10-18(11-5-3-2-4-6-11)23(20,21)12-7-8-13(16)14(17)9-12/h2-9H,10H2,1H3 |
| InChIKey | WHVDIGVOPXZPMY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |