C15H12Cl3NO4S — CID 50890323
methyl 2-(4-chloro-N-(3,4-dichlorophenyl)sulfonylanilino)acetate (PubChem CID 50890323) has the molecular formula C15H12Cl3NO4S and a molecular weight of 408.69 g/mol. Its IUPAC name is methyl 2-(4-chloro-N-(3,4-dichlorophenyl)sulfonylanilino)acetate.
| Compound Name | methyl 2-(4-chloro-N-(3,4-dichlorophenyl)sulfonylanilino)acetate |
|---|---|
| PubChem CID | 50890323 |
| Molecular Formula | C15H12Cl3NO4S |
| Molecular Weight | 408.69 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | methyl 2-(4-chloro-N-(3,4-dichlorophenyl)sulfonylanilino)acetate |
| SMILES | COC(=O)CN(c1ccc(Cl)cc1)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl3NO4S/c1-23-15(20)9-19(11-4-2-10(16)3-5-11)24(21,22)12-6-7-13(17)14(18)8-12/h2-8H,9H2,1H3 |
| InChIKey | DPVUZLRONYUMQN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.69 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |