C16H12ClF4NO4S — CID 100503773
methyl 2-[4-chloro-N-(4-fluorophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetate (PubChem CID 100503773) has the molecular formula C16H12ClF4NO4S and a molecular weight of 425.79 g/mol. Its IUPAC name is methyl 2-[4-chloro-N-(4-fluorophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetate.
| Compound Name | methyl 2-[4-chloro-N-(4-fluorophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetate |
|---|---|
| PubChem CID | 100503773 |
| Molecular Formula | C16H12ClF4NO4S |
| Molecular Weight | 425.79 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | methyl 2-[4-chloro-N-(4-fluorophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetate |
| SMILES | COC(=O)CN(c1ccc(Cl)c(C(F)(F)F)c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H12ClF4NO4S/c1-26-15(23)9-22(27(24,25)12-5-2-10(18)3-6-12)11-4-7-14(17)13(8-11)16(19,20)21/h2-8H,9H2,1H3 |
| InChIKey | LQICPRAORPNKJU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.79 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |