C17H17ClFNO4S — CID 50895637
ethyl 2-(4-chloro-N-(4-fluorophenyl)sulfonyl-3-methylanilino)acetate (PubChem CID 50895637) has the molecular formula C17H17ClFNO4S and a molecular weight of 385.84 g/mol. Its IUPAC name is ethyl 2-(4-chloro-N-(4-fluorophenyl)sulfonyl-3-methylanilino)acetate.
| Compound Name | ethyl 2-(4-chloro-N-(4-fluorophenyl)sulfonyl-3-methylanilino)acetate |
|---|---|
| PubChem CID | 50895637 |
| Molecular Formula | C17H17ClFNO4S |
| Molecular Weight | 385.84 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | ethyl 2-(4-chloro-N-(4-fluorophenyl)sulfonyl-3-methylanilino)acetate |
| SMILES | CCOC(=O)CN(c1ccc(Cl)c(C)c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17ClFNO4S/c1-3-24-17(21)11-20(14-6-9-16(18)12(2)10-14)25(22,23)15-7-4-13(19)5-8-15/h4-10H,3,11H2,1-2H3 |
| InChIKey | YTJILQCQJXLNAR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.84 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |