C16H15ClFNO4S — CID 50895710
3-(4-chloro-N-(4-fluorophenyl)sulfonyl-3-methylanilino)propanoic acid (PubChem CID 50895710) has the molecular formula C16H15ClFNO4S and a molecular weight of 371.82 g/mol. Its IUPAC name is 3-(4-chloro-N-(4-fluorophenyl)sulfonyl-3-methylanilino)propanoic acid.
| Compound Name | 3-(4-chloro-N-(4-fluorophenyl)sulfonyl-3-methylanilino)propanoic acid |
|---|---|
| PubChem CID | 50895710 |
| Molecular Formula | C16H15ClFNO4S |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 3-(4-chloro-N-(4-fluorophenyl)sulfonyl-3-methylanilino)propanoic acid |
| SMILES | Cc1cc(N(CCC(=O)O)S(=O)(=O)c2ccc(F)cc2)ccc1Cl |
| InChI | InChI=1S/C16H15ClFNO4S/c1-11-10-13(4-7-15(11)17)19(9-8-16(20)21)24(22,23)14-5-2-12(18)3-6-14/h2-7,10H,8-9H2,1H3,(H,20,21) |
| InChIKey | UQKRBPRLCPYIRV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |