C16H14ClFN2O6S — CID 50894193
4-(2-chloro-N-(4-fluorophenyl)sulfonyl-5-nitroanilino)butanoic acid (PubChem CID 50894193) has the molecular formula C16H14ClFN2O6S and a molecular weight of 416.81 g/mol. Its IUPAC name is 4-(2-chloro-N-(4-fluorophenyl)sulfonyl-5-nitroanilino)butanoic acid.
| Compound Name | 4-(2-chloro-N-(4-fluorophenyl)sulfonyl-5-nitroanilino)butanoic acid |
|---|---|
| PubChem CID | 50894193 |
| Molecular Formula | C16H14ClFN2O6S |
| Molecular Weight | 416.81 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 4-(2-chloro-N-(4-fluorophenyl)sulfonyl-5-nitroanilino)butanoic acid |
| SMILES | O=C(O)CCCN(c1cc([N+](=O)[O-])ccc1Cl)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H14ClFN2O6S/c17-14-8-5-12(20(23)24)10-15(14)19(9-1-2-16(21)22)27(25,26)13-6-3-11(18)4-7-13/h3-8,10H,1-2,9H2,(H,21,22) |
| InChIKey | DIDBFIQRHSYENA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.81 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|