C16H16N2O6S — CID 50894165
3-[N-(benzenesulfonyl)-2-methyl-4-nitroanilino]propanoic acid (PubChem CID 50894165) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is 3-[N-(benzenesulfonyl)-2-methyl-4-nitroanilino]propanoic acid.
| Compound Name | 3-[N-(benzenesulfonyl)-2-methyl-4-nitroanilino]propanoic acid |
|---|---|
| PubChem CID | 50894165 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 3-[N-(benzenesulfonyl)-2-methyl-4-nitroanilino]propanoic acid |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N(CCC(=O)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O6S/c1-12-11-13(18(21)22)7-8-15(12)17(10-9-16(19)20)25(23,24)14-5-3-2-4-6-14/h2-8,11H,9-10H2,1H3,(H,19,20) |
| InChIKey | YLDALDUCDAIDBA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|