C19H23NO4S — CID 50891803
4-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)butanoic acid (PubChem CID 50891803) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is 4-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)butanoic acid.
| Compound Name | 4-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)butanoic acid |
|---|---|
| PubChem CID | 50891803 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 4-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)butanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCC(=O)O)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C19H23NO4S/c1-14-6-9-17(10-7-14)25(23,24)20(12-4-5-19(21)22)18-11-8-15(2)13-16(18)3/h6-11,13H,4-5,12H2,1-3H3,(H,21,22) |
| InChIKey | HYKMKVSHWLABEP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |