C19H23NO6S — CID 50895111
4-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)butanoic acid (PubChem CID 50895111) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is 4-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)butanoic acid.
| Compound Name | 4-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)butanoic acid |
|---|---|
| PubChem CID | 50895111 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 4-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)butanoic acid |
| SMILES | COc1ccc(OC)c(N(CCCC(=O)O)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C19H23NO6S/c1-14-6-9-16(10-7-14)27(23,24)20(12-4-5-19(21)22)17-13-15(25-2)8-11-18(17)26-3/h6-11,13H,4-5,12H2,1-3H3,(H,21,22) |
| InChIKey | PLQJHEDYMMRXGY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |