C17H18NO5S- — CID 2273005
2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetate (PubChem CID 2273005) has the molecular formula C17H18NO5S- and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetate.
| Compound Name | 2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetate |
|---|---|
| PubChem CID | 2273005 |
| Molecular Formula | C17H18NO5S- |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetate |
| SMILES | COc1ccc(C)cc1N(CC(=O)[O-])S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H19NO5S/c1-12-4-7-14(8-5-12)24(21,22)18(11-17(19)20)15-10-13(2)6-9-16(15)23-3/h4-10H,11H2,1-3H3,(H,19,20)/p-1 |
| InChIKey | XHKZNQPUPAJKTR-UHFFFAOYSA-M |
| XLogP | 1.26 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |