C18H20N2O7S — CID 100527321
ethyl 2-(2-methoxy-5-methyl-N-(4-nitrophenyl)sulfonylanilino)acetate (PubChem CID 100527321) has the molecular formula C18H20N2O7S and a molecular weight of 408.43 g/mol. Its IUPAC name is ethyl 2-(2-methoxy-5-methyl-N-(4-nitrophenyl)sulfonylanilino)acetate.
| Compound Name | ethyl 2-(2-methoxy-5-methyl-N-(4-nitrophenyl)sulfonylanilino)acetate |
|---|---|
| PubChem CID | 100527321 |
| Molecular Formula | C18H20N2O7S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | ethyl 2-(2-methoxy-5-methyl-N-(4-nitrophenyl)sulfonylanilino)acetate |
| SMILES | CCOC(=O)CN(c1cc(C)ccc1OC)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H20N2O7S/c1-4-27-18(21)12-19(16-11-13(2)5-10-17(16)26-3)28(24,25)15-8-6-14(7-9-15)20(22)23/h5-11H,4,12H2,1-3H3 |
| InChIKey | KSEUPYHZHLTIPV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|