C22H23NO6S — CID 100531956
ethyl 2-(2,5-dimethoxy-N-naphthalen-2-ylsulfonylanilino)acetate (PubChem CID 100531956) has the molecular formula C22H23NO6S and a molecular weight of 429.49 g/mol. Its IUPAC name is ethyl 2-(2,5-dimethoxy-N-naphthalen-2-ylsulfonylanilino)acetate.
| Compound Name | ethyl 2-(2,5-dimethoxy-N-naphthalen-2-ylsulfonylanilino)acetate |
|---|---|
| PubChem CID | 100531956 |
| Molecular Formula | C22H23NO6S |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | ethyl 2-(2,5-dimethoxy-N-naphthalen-2-ylsulfonylanilino)acetate |
| SMILES | CCOC(=O)CN(c1cc(OC)ccc1OC)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H23NO6S/c1-4-29-22(24)15-23(20-14-18(27-2)10-12-21(20)28-3)30(25,26)19-11-9-16-7-5-6-8-17(16)13-19/h5-14H,4,15H2,1-3H3 |
| InChIKey | KATUCLRGYMKPGX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |