C16H16N2O7S — CID 28590072
2-(2-methoxy-N-(4-methylphenyl)sulfonyl-5-nitroanilino)acetic acid (PubChem CID 28590072) has the molecular formula C16H16N2O7S and a molecular weight of 380.38 g/mol. Its IUPAC name is 2-(2-methoxy-N-(4-methylphenyl)sulfonyl-5-nitroanilino)acetic acid.
| Compound Name | 2-(2-methoxy-N-(4-methylphenyl)sulfonyl-5-nitroanilino)acetic acid |
|---|---|
| PubChem CID | 28590072 |
| Molecular Formula | C16H16N2O7S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-(2-methoxy-N-(4-methylphenyl)sulfonyl-5-nitroanilino)acetic acid |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(CC(=O)O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H16N2O7S/c1-11-3-6-13(7-4-11)26(23,24)17(10-16(19)20)14-9-12(18(21)22)5-8-15(14)25-2/h3-9H,10H2,1-2H3,(H,19,20) |
| InChIKey | BGQLNXDSCQDDSU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|