C18H20N2O8S — CID 50895169
4-(2,5-dimethoxy-N-(3-nitrophenyl)sulfonylanilino)butanoic acid (PubChem CID 50895169) has the molecular formula C18H20N2O8S and a molecular weight of 424.43 g/mol. Its IUPAC name is 4-(2,5-dimethoxy-N-(3-nitrophenyl)sulfonylanilino)butanoic acid.
| Compound Name | 4-(2,5-dimethoxy-N-(3-nitrophenyl)sulfonylanilino)butanoic acid |
|---|---|
| PubChem CID | 50895169 |
| Molecular Formula | C18H20N2O8S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 4-(2,5-dimethoxy-N-(3-nitrophenyl)sulfonylanilino)butanoic acid |
| SMILES | COc1ccc(OC)c(N(CCCC(=O)O)S(=O)(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C18H20N2O8S/c1-27-14-8-9-17(28-2)16(12-14)19(10-4-7-18(21)22)29(25,26)15-6-3-5-13(11-15)20(23)24/h3,5-6,8-9,11-12H,4,7,10H2,1-2H3,(H,21,22) |
| InChIKey | XFXIYSRWSIVQSW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|