C17H17ClN2O7S — CID 50895272
4-(5-chloro-2-methoxy-N-(2-nitrophenyl)sulfonylanilino)butanoic acid (PubChem CID 50895272) has the molecular formula C17H17ClN2O7S and a molecular weight of 428.85 g/mol. Its IUPAC name is 4-(5-chloro-2-methoxy-N-(2-nitrophenyl)sulfonylanilino)butanoic acid.
| Compound Name | 4-(5-chloro-2-methoxy-N-(2-nitrophenyl)sulfonylanilino)butanoic acid |
|---|---|
| PubChem CID | 50895272 |
| Molecular Formula | C17H17ClN2O7S |
| Molecular Weight | 428.85 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 4-(5-chloro-2-methoxy-N-(2-nitrophenyl)sulfonylanilino)butanoic acid |
| SMILES | COc1ccc(Cl)cc1N(CCCC(=O)O)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17ClN2O7S/c1-27-15-9-8-12(18)11-14(15)19(10-4-7-17(21)22)28(25,26)16-6-3-2-5-13(16)20(23)24/h2-3,5-6,8-9,11H,4,7,10H2,1H3,(H,21,22) |
| InChIKey | INTIHEUCHSFHPP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.85 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|