C17H18N2O8S — CID 997555
methyl 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetate (PubChem CID 997555) has the molecular formula C17H18N2O8S and a molecular weight of 410.40 g/mol. Its IUPAC name is methyl 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetate.
| Compound Name | methyl 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetate |
|---|---|
| PubChem CID | 997555 |
| Molecular Formula | C17H18N2O8S |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | methyl 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetate |
| SMILES | COC(=O)CN(c1ccc(OC)cc1OC)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N2O8S/c1-25-12-8-9-13(15(10-12)26-2)18(11-17(20)27-3)28(23,24)16-7-5-4-6-14(16)19(21)22/h4-10H,11H2,1-3H3 |
| InChIKey | FZOFYRLGMSKDQQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|