C35H38N6O14S2 — CID 43891798
2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-[2-[[2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetyl]amino]propyl]acetamide (PubChem CID 43891798) has the molecular formula C35H38N6O14S2 and a molecular weight of 830.85 g/mol. Its IUPAC name is 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-[2-[[2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetyl]amino]propyl]acetamide.
| Compound Name | 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-[2-[[2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetyl]amino]propyl]acetamide |
|---|---|
| PubChem CID | 43891798 |
| Molecular Formula | C35H38N6O14S2 |
| Molecular Weight | 830.85 g/mol |
| Exact Mass | 830.19 |
| IUPAC Name | 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-[2-[[2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetyl]amino]propyl]acetamide |
| SMILES | COc1ccc(N(CC(=O)NCC(C)NC(=O)CN(c2ccc(OC)cc2OC)S(=O)(=O)c2ccccc2[N+](=O)[O-])S(=O)(=O)c2ccccc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C35H38N6O14S2/c1-23(37-35(43)22-39(27-17-15-25(53-3)19-31(27)55-5)57(50,51)33-13-9-7-11-29(33)41(46)47)20-36-34(42)21-38(26-16-14-24(52-2)18-30(26)54-4)56(48,49)32-12-8-6-10-28(32)40(44)45/h6-19,23H,20-22H2,1-5H3,(H,36,42)(H,37,43) |
| InChIKey | CFHGIDJAZJOLRD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 256.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.85 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|