C22H26N4O7S — CID 28588789
N-(cyclohexylideneamino)-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 28588789) has the molecular formula C22H26N4O7S and a molecular weight of 490.54 g/mol. Its IUPAC name is N-(cyclohexylideneamino)-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N-(cyclohexylideneamino)-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 28588789 |
| Molecular Formula | C22H26N4O7S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | N-(cyclohexylideneamino)-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)NN=C2CCCCC2)S(=O)(=O)c2ccccc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C22H26N4O7S/c1-32-17-12-13-18(20(14-17)33-2)25(15-22(27)24-23-16-8-4-3-5-9-16)34(30,31)21-11-7-6-10-19(21)26(28)29/h6-7,10-14H,3-5,8-9,15H2,1-2H3,(H,24,27) |
| InChIKey | ZVFBGTMJXCZNAO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|